C27H26N2O4 — CID 57212517
2-[[5-[2-[(1-phenyl-2-pyridin-3-ylethenyl)amino]oxyethyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 57212517) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[[5-[2-[(1-phenyl-2-pyridin-3-ylethenyl)amino]oxyethyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[5-[2-[(1-phenyl-2-pyridin-3-ylethenyl)amino]oxyethyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 57212517 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-[[5-[2-[(1-phenyl-2-pyridin-3-ylethenyl)amino]oxyethyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1CCC=C2CCONC(=Cc1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O4/c30-27(31)19-32-26-13-5-11-23-21(10-4-12-24(23)26)14-16-33-29-25(22-8-2-1-3-9-22)17-20-7-6-15-28-18-20/h1-3,5-11,13,15,17-18,29H,4,12,14,16,19H2,(H,30,31) |
| InChIKey | VPVWTKVRBJKATD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|