About 1-azatricyclo[7.3.1.05,13]trideca-3,5(13),11-trien-6-one
1-azatricyclo[7.3.1.05,13]trideca-3,5(13),11-trien-6-one (PubChem CID 57212606) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-azatricyclo[7.3.1.05,13]trideca-3,5(13),11-trien-6-one.
Analyze 1-azatricyclo[7.3.1.05,13]trideca-3,5(13),11-trien-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azatricyclo[7.3.1.05,13]trideca-3,5(13),11-trien-6-one?
The IUPAC name of 1-azatricyclo[7.3.1.05,13]trideca-3,5(13),11-trien-6-one (CID 57212606) is 1-azatricyclo[7.3.1.05,13]trideca-3,5(13),11-trien-6-one.
What is the SMILES notation for 1-azatricyclo[7.3.1.05,13]trideca-3,5(13),11-trien-6-one?
The canonical SMILES for 1-azatricyclo[7.3.1.05,13]trideca-3,5(13),11-trien-6-one is O=C1CCC2CC=CN3CC=CC1=C23.
What is the InChIKey of 1-azatricyclo[7.3.1.05,13]trideca-3,5(13),11-trien-6-one?
The InChIKey is YHIVKNGUHQATQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c14-11-6-5-9-3-1-7-13-8-2-4-10(11)12(9)13/h1-2,4,7,9H,3,5-6,8H2.
What are the key properties of 1-azatricyclo[7.3.1.05,13]trideca-3,5(13),11-trien-6-one?
1-azatricyclo[7.3.1.05,13]trideca-3,5(13),11-trien-6-one has a molecular weight of 187.24 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azatricyclo[7.3.1.05,13]trideca-3,5(13),11-trien-6-one is sourced from PubChem (CID 57212606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).