C8H19N5O — CID 57212739
2-[(4S)-4,6-diamino-5-oxoheptyl]guanidine (PubChem CID 57212739) has the molecular formula C8H19N5O and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-[(4S)-4,6-diamino-5-oxoheptyl]guanidine.
| Compound Name | 2-[(4S)-4,6-diamino-5-oxoheptyl]guanidine |
|---|---|
| PubChem CID | 57212739 |
| Molecular Formula | C8H19N5O |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 2-[(4S)-4,6-diamino-5-oxoheptyl]guanidine |
| SMILES | CC(N)C(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C8H19N5O/c1-5(9)7(14)6(10)3-2-4-13-8(11)12/h5-6H,2-4,9-10H2,1H3,(H4,11,12,13)/t5?,6-/m0/s1 |
| InChIKey | BPYQVOWKZNLTCU-GDVGLLTNSA-N |
| XLogP | -1.72 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|