About 4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol
4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol (PubChem CID 57213117) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol.
Molecular Properties
| Compound Name | 4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol |
| PubChem CID | 57213117 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol |
| SMILES | OC1(C2=C3C=COC=C3CC2)CCNCC1 |
| InChI | InChI=1S/C13H17NO2/c15-13(4-6-14-7-5-13)12-2-1-10-9-16-8-3-11(10)12/h3,8-9,14-15H,1-2,4-7H2 |
| InChIKey | PQTJDJHASSQYRP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol?
The IUPAC name of 4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol (CID 57213117) is 4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol.
What is the SMILES notation for 4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol?
The canonical SMILES for 4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol is OC1(C2=C3C=COC=C3CC2)CCNCC1.
What is the InChIKey of 4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol?
The InChIKey is PQTJDJHASSQYRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c15-13(4-6-14-7-5-13)12-2-1-10-9-16-8-3-11(10)12/h3,8-9,14-15H,1-2,4-7H2.
What are the key properties of 4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol?
4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol has a molecular weight of 219.28 g/mol, XLogP of 1.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6,7-dihydrocyclopenta[c]pyran-5-yl)piperidin-4-ol is sourced from PubChem (CID 57213117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).