C25H16Cl3F5N4O2 — CID 57213304
3-methyl-5-[2,2,2-trichloro-1-(3-fluoro-N-(3-fluorophenyl)anilino)ethyl]imino-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 57213304) has the molecular formula C25H16Cl3F5N4O2 and a molecular weight of 605.78 g/mol. Its IUPAC name is 3-methyl-5-[2,2,2-trichloro-1-(3-fluoro-N-(3-fluorophenyl)anilino)ethyl]imino-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-methyl-5-[2,2,2-trichloro-1-(3-fluoro-N-(3-fluorophenyl)anilino)ethyl]imino-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 57213304 |
| Molecular Formula | C25H16Cl3F5N4O2 |
| Molecular Weight | 605.78 g/mol |
| Exact Mass | 604.03 |
| IUPAC Name | 3-methyl-5-[2,2,2-trichloro-1-(3-fluoro-N-(3-fluorophenyl)anilino)ethyl]imino-1-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(=NC(N(c2cccc(F)c2)c2cccc(F)c2)C(Cl)(Cl)Cl)N(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C25H16Cl3F5N4O2/c1-35-21(38)20(37(23(35)39)17-8-2-5-14(11-17)25(31,32)33)34-22(24(26,27)28)36(18-9-3-6-15(29)12-18)19-10-4-7-16(30)13-19/h2-13,22H,1H3 |
| InChIKey | BIMYLMGKZDHOKF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.78 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|