C12H12F3NO — CID 57213441
(3S)-3-ethenyl-2-(trifluoromethyl)-1,2,3,5-tetrahydro-4,1-benzoxazepine (PubChem CID 57213441) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is (3S)-3-ethenyl-2-(trifluoromethyl)-1,2,3,5-tetrahydro-4,1-benzoxazepine.
| Compound Name | (3S)-3-ethenyl-2-(trifluoromethyl)-1,2,3,5-tetrahydro-4,1-benzoxazepine |
|---|---|
| PubChem CID | 57213441 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (3S)-3-ethenyl-2-(trifluoromethyl)-1,2,3,5-tetrahydro-4,1-benzoxazepine |
| SMILES | C=C[C@@H]1OCc2ccccc2NC1C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO/c1-2-10-11(12(13,14)15)16-9-6-4-3-5-8(9)7-17-10/h2-6,10-11,16H,1,7H2/t10-,11?/m0/s1 |
| InChIKey | YQXQDJAFCWNHSR-VUWPPUDQSA-N |
| XLogP | 3.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|