C10H19N5S — CID 57213474
[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]methanethiol (PubChem CID 57213474) has the molecular formula C10H19N5S and a molecular weight of 241.36 g/mol. Its IUPAC name is [4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]methanethiol.
| Compound Name | [4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]methanethiol |
|---|---|
| PubChem CID | 57213474 |
| Molecular Formula | C10H19N5S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | [4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]methanethiol |
| SMILES | CC(C)Nc1nc(CS)nc(NC(C)C)n1 |
| InChI | InChI=1S/C10H19N5S/c1-6(2)11-9-13-8(5-16)14-10(15-9)12-7(3)4/h6-7,16H,5H2,1-4H3,(H2,11,12,13,14,15) |
| InChIKey | VLKUVUUUHZHXHT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|