C8H12ClF5 — CID 57213638
6-chloro-3-ethyl-1,1,1,2,2-pentafluorohexane (PubChem CID 57213638) has the molecular formula C8H12ClF5 and a molecular weight of 238.63 g/mol. Its IUPAC name is 6-chloro-3-ethyl-1,1,1,2,2-pentafluorohexane.
| Compound Name | 6-chloro-3-ethyl-1,1,1,2,2-pentafluorohexane |
|---|---|
| PubChem CID | 57213638 |
| Molecular Formula | C8H12ClF5 |
| Molecular Weight | 238.63 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 6-chloro-3-ethyl-1,1,1,2,2-pentafluorohexane |
| SMILES | CCC(CCCCl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H12ClF5/c1-2-6(4-3-5-9)7(10,11)8(12,13)14/h6H,2-5H2,1H3 |
| InChIKey | WLXDROIIDIZSTL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|