C17H17NO2 — CID 57213685
(1Z)-N-methyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaene-9-carboxamide (PubChem CID 57213685) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (1Z)-N-methyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaene-9-carboxamide.
| Compound Name | (1Z)-N-methyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaene-9-carboxamide |
|---|---|
| PubChem CID | 57213685 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (1Z)-N-methyl-8-oxatricyclo[10.4.0.02,7]hexadeca-1,3,5,11,13,15-hexaene-9-carboxamide |
| SMILES | CNC(=O)C1CC=c2cccc/c2=C2\C=CC=CC2O1 |
| InChI | InChI=1S/C17H17NO2/c1-18-17(19)16-11-10-12-6-2-3-7-13(12)14-8-4-5-9-15(14)20-16/h2-10,15-16H,11H2,1H3,(H,18,19)/b12-10?,14-13- |
| InChIKey | QVHBKCVNDJYFIW-VNZFERIISA-N |
| XLogP | 0.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |