About 2-chloropent-4-ynamide
2-chloropent-4-ynamide (PubChem CID 57213784) has the molecular formula C5H6ClNO
and a molecular weight of 131.56 g/mol. Its IUPAC name is 2-chloropent-4-ynamide.
Molecular Properties
| Compound Name | 2-chloropent-4-ynamide |
| PubChem CID | 57213784 |
| Molecular Formula | C5H6ClNO |
| Molecular Weight | 131.56 g/mol |
| Exact Mass | 131.01 |
| IUPAC Name | 2-chloropent-4-ynamide |
| SMILES | C#CCC(Cl)C(N)=O |
| InChI | InChI=1S/C5H6ClNO/c1-2-3-4(6)5(7)8/h1,4H,3H2,(H2,7,8) |
| InChIKey | HEZCIBVMPPYWRH-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.56 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropent-4-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropent-4-ynamide?
The IUPAC name of 2-chloropent-4-ynamide (CID 57213784) is 2-chloropent-4-ynamide.
What is the SMILES notation for 2-chloropent-4-ynamide?
The canonical SMILES for 2-chloropent-4-ynamide is C#CCC(Cl)C(N)=O.
What is the InChIKey of 2-chloropent-4-ynamide?
The InChIKey is HEZCIBVMPPYWRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6ClNO/c1-2-3-4(6)5(7)8/h1,4H,3H2,(H2,7,8).
What are the key properties of 2-chloropent-4-ynamide?
2-chloropent-4-ynamide has a molecular weight of 131.56 g/mol, XLogP of 0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropent-4-ynamide is sourced from PubChem (CID 57213784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).