C24H30F3N3O6 — CID 57214213
[[2-[4-[2-[2-ethoxy-1-(methylamino)-2-oxoethyl]morpholin-4-yl]-2,3,5-trifluorobenzoyl]cyclopropyl]amino] 2-methylidenebutanoate (PubChem CID 57214213) has the molecular formula C24H30F3N3O6 and a molecular weight of 513.51 g/mol. Its IUPAC name is [[2-[4-[2-[2-ethoxy-1-(methylamino)-2-oxoethyl]morpholin-4-yl]-2,3,5-trifluorobenzoyl]cyclopropyl]amino] 2-methylidenebutanoate.
| Compound Name | [[2-[4-[2-[2-ethoxy-1-(methylamino)-2-oxoethyl]morpholin-4-yl]-2,3,5-trifluorobenzoyl]cyclopropyl]amino] 2-methylidenebutanoate |
|---|---|
| PubChem CID | 57214213 |
| Molecular Formula | C24H30F3N3O6 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | [[2-[4-[2-[2-ethoxy-1-(methylamino)-2-oxoethyl]morpholin-4-yl]-2,3,5-trifluorobenzoyl]cyclopropyl]amino] 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)ONC1CC1C(=O)c1cc(F)c(N2CCOC(C(NC)C(=O)OCC)C2)c(F)c1F |
| InChI | InChI=1S/C24H30F3N3O6/c1-5-12(3)23(32)36-29-16-10-13(16)22(31)14-9-15(25)21(19(27)18(14)26)30-7-8-35-17(11-30)20(28-4)24(33)34-6-2/h9,13,16-17,20,28-29H,3,5-8,10-11H2,1-2,4H3 |
| InChIKey | XFAVZVIOVWRZIR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|