About 1H-indole-4,6,7-triamine
1H-indole-4,6,7-triamine (PubChem CID 57214260) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 1H-indole-4,6,7-triamine.
Molecular Properties
| Compound Name | 1H-indole-4,6,7-triamine |
| PubChem CID | 57214260 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1H-indole-4,6,7-triamine |
| SMILES | Nc1cc(N)c2cc[nH]c2c1N |
| InChI | InChI=1S/C8H10N4/c9-5-3-6(10)7(11)8-4(5)1-2-12-8/h1-3,12H,9-11H2 |
| InChIKey | LFHSAUTWHMOBDJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 93.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole-4,6,7-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-4,6,7-triamine?
The IUPAC name of 1H-indole-4,6,7-triamine (CID 57214260) is 1H-indole-4,6,7-triamine.
What is the SMILES notation for 1H-indole-4,6,7-triamine?
The canonical SMILES for 1H-indole-4,6,7-triamine is Nc1cc(N)c2cc[nH]c2c1N.
What is the InChIKey of 1H-indole-4,6,7-triamine?
The InChIKey is LFHSAUTWHMOBDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c9-5-3-6(10)7(11)8-4(5)1-2-12-8/h1-3,12H,9-11H2.
What are the key properties of 1H-indole-4,6,7-triamine?
1H-indole-4,6,7-triamine has a molecular weight of 162.20 g/mol, XLogP of 0.91, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-4,6,7-triamine is sourced from PubChem (CID 57214260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).