C21H21N3O — CID 57214409
2-(2,4,6-trimethylanilino)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 57214409) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-(2,4,6-trimethylanilino)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 2-(2,4,6-trimethylanilino)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 57214409 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-(2,4,6-trimethylanilino)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | Cc1cc(C)c(Nc2cc3n(c(=O)n2)CCc2ccccc2-3)c(C)c1 |
| InChI | InChI=1S/C21H21N3O/c1-13-10-14(2)20(15(3)11-13)22-19-12-18-17-7-5-4-6-16(17)8-9-24(18)21(25)23-19/h4-7,10-12H,8-9H2,1-3H3,(H,22,23,25) |
| InChIKey | ZBHMIUTUVXIVIW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |