C12H14IN3O3 — CID 57214659
1-[(1R,2R,4R,5R)-1,5-dihydroxy-4,6,6-trimethyl-3-oxabicyclo[3.1.0]hexan-2-yl]-5-iodoimidazole-4-carbonitrile (PubChem CID 57214659) has the molecular formula C12H14IN3O3 and a molecular weight of 375.17 g/mol. Its IUPAC name is 1-[(1R,2R,4R,5R)-1,5-dihydroxy-4,6,6-trimethyl-3-oxabicyclo[3.1.0]hexan-2-yl]-5-iodoimidazole-4-carbonitrile.
| Compound Name | 1-[(1R,2R,4R,5R)-1,5-dihydroxy-4,6,6-trimethyl-3-oxabicyclo[3.1.0]hexan-2-yl]-5-iodoimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 57214659 |
| Molecular Formula | C12H14IN3O3 |
| Molecular Weight | 375.17 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 1-[(1R,2R,4R,5R)-1,5-dihydroxy-4,6,6-trimethyl-3-oxabicyclo[3.1.0]hexan-2-yl]-5-iodoimidazole-4-carbonitrile |
| SMILES | C[C@H]1O[C@@H](n2cnc(C#N)c2I)[C@@]2(O)C(C)(C)[C@@]12O |
| InChI | InChI=1S/C12H14IN3O3/c1-6-11(17)10(2,3)12(11,18)9(19-6)16-5-15-7(4-14)8(16)13/h5-6,9,17-18H,1-3H3/t6-,9-,11+,12-/m1/s1 |
| InChIKey | CESZZEOCLYOSRJ-URHLEADWSA-N |
| XLogP | 0.78 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|