C27H34FN5O8 — CID 57215416
(4S,12aS)-4,7-bis(dimethylamino)-9-[[2-(dimethylamino)acetyl]amino]-8-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 57215416) has the molecular formula C27H34FN5O8 and a molecular weight of 575.59 g/mol. Its IUPAC name is (4S,12aS)-4,7-bis(dimethylamino)-9-[[2-(dimethylamino)acetyl]amino]-8-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-4,7-bis(dimethylamino)-9-[[2-(dimethylamino)acetyl]amino]-8-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 57215416 |
| Molecular Formula | C27H34FN5O8 |
| Molecular Weight | 575.59 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | (4S,12aS)-4,7-bis(dimethylamino)-9-[[2-(dimethylamino)acetyl]amino]-8-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)CC(=O)Nc1c(O)c2c(c(N(C)C)c1F)CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C27H34FN5O8/c1-31(2)9-13(34)30-18-17(28)19(32(3)4)11-7-10-8-12-20(33(5)6)23(37)16(26(29)40)25(39)27(12,41)24(38)14(10)21(35)15(11)22(18)36/h10,12,14,16,20,36,41H,7-9H2,1-6H3,(H2,29,40)(H,30,34)/t10?,12?,14?,16?,20-,27-/m0/s1 |
| InChIKey | QUJDKPWJIXQGAI-MJLLMHTQSA-N |
| XLogP | -1.43 |
| TPSA | 190.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.59 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|