C8H11NO — CID 57215494
3,5,6,8a-tetrahydro-2H-indolizin-1-one (PubChem CID 57215494) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 3,5,6,8a-tetrahydro-2H-indolizin-1-one.
| Compound Name | 3,5,6,8a-tetrahydro-2H-indolizin-1-one |
|---|---|
| PubChem CID | 57215494 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 3,5,6,8a-tetrahydro-2H-indolizin-1-one |
| SMILES | O=C1CCN2CCC=CC12 |
| InChI | InChI=1S/C8H11NO/c10-8-4-6-9-5-2-1-3-7(8)9/h1,3,7H,2,4-6H2 |
| InChIKey | SCBANQKERPEQAC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|