C12H19N4+ — CID 57215732
2-(4,5-dihydro-1H-imidazol-2-yl)-1,1-bis(prop-2-enyl)-4,5-dihydroimidazol-1-ium (PubChem CID 57215732) has the molecular formula C12H19N4+ and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-2-yl)-1,1-bis(prop-2-enyl)-4,5-dihydroimidazol-1-ium.
| Compound Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-1,1-bis(prop-2-enyl)-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 57215732 |
| Molecular Formula | C12H19N4+ |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-1,1-bis(prop-2-enyl)-4,5-dihydroimidazol-1-ium |
| SMILES | C=CC[N+]1(CC=C)CCN=C1C1=NCCN1 |
| InChI | InChI=1S/C12H19N4/c1-3-8-16(9-4-2)10-7-15-12(16)11-13-5-6-14-11/h3-4H,1-2,5-10H2,(H,13,14)/q+1 |
| InChIKey | CQLMOCSJAQSSEB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|