C16H26O — CID 57215776
(4S,5R)-5-butyl-2,2,4-trimethyl-3,4,5,6-tetrahydrochromene (PubChem CID 57215776) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (4S,5R)-5-butyl-2,2,4-trimethyl-3,4,5,6-tetrahydrochromene.
| Compound Name | (4S,5R)-5-butyl-2,2,4-trimethyl-3,4,5,6-tetrahydrochromene |
|---|---|
| PubChem CID | 57215776 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (4S,5R)-5-butyl-2,2,4-trimethyl-3,4,5,6-tetrahydrochromene |
| SMILES | CCCC[C@@H]1CC=CC2=C1[C@@H](C)CC(C)(C)O2 |
| InChI | InChI=1S/C16H26O/c1-5-6-8-13-9-7-10-14-15(13)12(2)11-16(3,4)17-14/h7,10,12-13H,5-6,8-9,11H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | CRRYALLZSKYYSG-QWHCGFSZSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |