C23H27ClN4O2 — CID 57216574
[(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(6-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl)carbamate (PubChem CID 57216574) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(6-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl)carbamate.
| Compound Name | [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(6-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl)carbamate |
|---|---|
| PubChem CID | 57216574 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-(6-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl)carbamate |
| SMILES | CN1CC[C@@]2(C)c3cc(OC(=O)NC4NCCc5cc(Cl)ccc54)ccc3N(C)[C@@H]12 |
| InChI | InChI=1S/C23H27ClN4O2/c1-23-9-11-27(2)21(23)28(3)19-7-5-16(13-18(19)23)30-22(29)26-20-17-6-4-15(24)12-14(17)8-10-25-20/h4-7,12-13,20-21,25H,8-11H2,1-3H3,(H,26,29)/t20?,21-,23+/m1/s1 |
| InChIKey | AIEYBZQROXMANV-VBFAWGIDSA-N |
| XLogP | 3.64 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |