C24H31NO5 — CID 57216932
4-[1-[3-[(5-methylhexylamino)methyl]phenoxy]ethyl]phthalic acid (PubChem CID 57216932) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is 4-[1-[3-[(5-methylhexylamino)methyl]phenoxy]ethyl]phthalic acid.
| Compound Name | 4-[1-[3-[(5-methylhexylamino)methyl]phenoxy]ethyl]phthalic acid |
|---|---|
| PubChem CID | 57216932 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 4-[1-[3-[(5-methylhexylamino)methyl]phenoxy]ethyl]phthalic acid |
| SMILES | CC(C)CCCCNCc1cccc(OC(C)c2ccc(C(=O)O)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C24H31NO5/c1-16(2)7-4-5-12-25-15-18-8-6-9-20(13-18)30-17(3)19-10-11-21(23(26)27)22(14-19)24(28)29/h6,8-11,13-14,16-17,25H,4-5,7,12,15H2,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | HUCLSLHARSFOJG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|