C20H29Cl2NO3 — CID 57217153
1-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]-N-[(2-methylpropan-2-yl)oxy]prop-1-en-2-amine (PubChem CID 57217153) has the molecular formula C20H29Cl2NO3 and a molecular weight of 402.36 g/mol. Its IUPAC name is 1-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]-N-[(2-methylpropan-2-yl)oxy]prop-1-en-2-amine.
| Compound Name | 1-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]-N-[(2-methylpropan-2-yl)oxy]prop-1-en-2-amine |
|---|---|
| PubChem CID | 57217153 |
| Molecular Formula | C20H29Cl2NO3 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 1-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]-N-[(2-methylpropan-2-yl)oxy]prop-1-en-2-amine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OC=C(C)NOC(C)(C)C |
| InChI | InChI=1S/C20H29Cl2NO3/c1-7-15-11-17(24-10-9-18(21)22)12-16(8-2)19(15)25-13-14(3)23-26-20(4,5)6/h9,11-13,23H,7-8,10H2,1-6H3 |
| InChIKey | QAAVXXFHPAFRTF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|