C15H13ClFN3O3 — CID 57219616
1-(5-but-2-ynoxy-4-chloro-2-fluorophenyl)-3,5-dimethyl-4-nitropyrazole (PubChem CID 57219616) has the molecular formula C15H13ClFN3O3 and a molecular weight of 337.74 g/mol. Its IUPAC name is 1-(5-but-2-ynoxy-4-chloro-2-fluorophenyl)-3,5-dimethyl-4-nitropyrazole.
| Compound Name | 1-(5-but-2-ynoxy-4-chloro-2-fluorophenyl)-3,5-dimethyl-4-nitropyrazole |
|---|---|
| PubChem CID | 57219616 |
| Molecular Formula | C15H13ClFN3O3 |
| Molecular Weight | 337.74 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 1-(5-but-2-ynoxy-4-chloro-2-fluorophenyl)-3,5-dimethyl-4-nitropyrazole |
| SMILES | CC#CCOc1cc(-n2nc(C)c([N+](=O)[O-])c2C)c(F)cc1Cl |
| InChI | InChI=1S/C15H13ClFN3O3/c1-4-5-6-23-14-8-13(12(17)7-11(14)16)19-10(3)15(20(21)22)9(2)18-19/h7-8H,6H2,1-3H3 |
| InChIKey | OHZJUEIMKVOOKJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.74 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|