C14H12N2O2 — CID 57219649
8-oxa-15,16-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11-pentaen-14-one (PubChem CID 57219649) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 8-oxa-15,16-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11-pentaen-14-one.
| Compound Name | 8-oxa-15,16-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11-pentaen-14-one |
|---|---|
| PubChem CID | 57219649 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 8-oxa-15,16-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11-pentaen-14-one |
| SMILES | O=C1NNC2c3ccccc3OC3=CC=CC1C32 |
| InChI | InChI=1S/C14H12N2O2/c17-14-9-5-3-7-11-12(9)13(15-16-14)8-4-1-2-6-10(8)18-11/h1-7,9,12-13,15H,(H,16,17) |
| InChIKey | CNPVDLKHHCXRIG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |