About (2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate
(2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate (PubChem CID 57219762) has the molecular formula C20H17NO4S
and a molecular weight of 367.43 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate |
| PubChem CID | 57219762 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate |
| SMILES | C=Cc1ccc(C(S)c2ccccc2C(=O)On2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C20H17NO4S/c1-2-13-7-9-14(10-8-13)19(26)15-5-3-4-6-16(15)20(24)25-21-17(22)11-12-18(21)23/h2-12,19,22-23,26H,1H2 |
| InChIKey | GOVCGDZSYBNDTF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate (CID 57219762) is (2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate is C=Cc1ccc(C(S)c2ccccc2C(=O)On2c(O)ccc2O)cc1.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate?
The InChIKey is GOVCGDZSYBNDTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO4S/c1-2-13-7-9-14(10-8-13)19(26)15-5-3-4-6-16(15)20(24)25-21-17(22)11-12-18(21)23/h2-12,19,22-23,26H,1H2.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate?
(2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate has a molecular weight of 367.43 g/mol, XLogP of 3.83, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 2-[(4-ethenylphenyl)-sulfanylmethyl]benzoate is sourced from PubChem (CID 57219762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).