C15H14Br3ClN4 — CID 57219803
2-[(4-bromo-2-chloroanilino)methyl]-1-(2,4-dibromophenyl)-1-methylguanidine (PubChem CID 57219803) has the molecular formula C15H14Br3ClN4 and a molecular weight of 525.47 g/mol. Its IUPAC name is 2-[(4-bromo-2-chloroanilino)methyl]-1-(2,4-dibromophenyl)-1-methylguanidine.
| Compound Name | 2-[(4-bromo-2-chloroanilino)methyl]-1-(2,4-dibromophenyl)-1-methylguanidine |
|---|---|
| PubChem CID | 57219803 |
| Molecular Formula | C15H14Br3ClN4 |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 521.85 |
| IUPAC Name | 2-[(4-bromo-2-chloroanilino)methyl]-1-(2,4-dibromophenyl)-1-methylguanidine |
| SMILES | CN(C(N)=NCNc1ccc(Br)cc1Cl)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H14Br3ClN4/c1-23(14-5-3-9(16)6-11(14)18)15(20)22-8-21-13-4-2-10(17)7-12(13)19/h2-7,21H,8H2,1H3,(H2,20,22) |
| InChIKey | NDFQNMUYAZCWOG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|