C15H26O5 — CID 57219883
6-hydroxy-2,2,5,5-tetramethyl-3-(2-methylbut-2-enoyloxy)hexanoic acid (PubChem CID 57219883) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is 6-hydroxy-2,2,5,5-tetramethyl-3-(2-methylbut-2-enoyloxy)hexanoic acid.
| Compound Name | 6-hydroxy-2,2,5,5-tetramethyl-3-(2-methylbut-2-enoyloxy)hexanoic acid |
|---|---|
| PubChem CID | 57219883 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 6-hydroxy-2,2,5,5-tetramethyl-3-(2-methylbut-2-enoyloxy)hexanoic acid |
| SMILES | CC=C(C)C(=O)OC(CC(C)(C)CO)C(C)(C)C(=O)O |
| InChI | InChI=1S/C15H26O5/c1-7-10(2)12(17)20-11(8-14(3,4)9-16)15(5,6)13(18)19/h7,11,16H,8-9H2,1-6H3,(H,18,19) |
| InChIKey | MSOMRGOGGAESNP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|