C22H22F2O5 — CID 57220247
(8R,9R,10R,13S,14S,17S)-6,9-difluoro-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-12,14,15,17-tetrahydro-8H-cyclopenta[a]phenanthrene-1,3,11-trione (PubChem CID 57220247) has the molecular formula C22H22F2O5 and a molecular weight of 404.41 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S,17S)-6,9-difluoro-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-12,14,15,17-tetrahydro-8H-cyclopenta[a]phenanthrene-1,3,11-trione.
| Compound Name | (8R,9R,10R,13S,14S,17S)-6,9-difluoro-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-12,14,15,17-tetrahydro-8H-cyclopenta[a]phenanthrene-1,3,11-trione |
|---|---|
| PubChem CID | 57220247 |
| Molecular Formula | C22H22F2O5 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (8R,9R,10R,13S,14S,17S)-6,9-difluoro-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-12,14,15,17-tetrahydro-8H-cyclopenta[a]phenanthrene-1,3,11-trione |
| SMILES | C=C1C[C@H]2[C@@H]3C=C(F)C4=CC(=O)CC(=O)[C@]4(C)[C@@]3(F)C(=O)C[C@]2(C)[C@H]1C(=O)CO |
| InChI | InChI=1S/C22H22F2O5/c1-10-4-12-13-7-15(23)14-5-11(26)6-17(28)21(14,3)22(13,24)18(29)8-20(12,2)19(10)16(27)9-25/h5,7,12-13,19,25H,1,4,6,8-9H2,2-3H3/t12-,13-,19+,20-,21+,22-/m0/s1 |
| InChIKey | QIKBDLJRPITAGO-KTENCOKQSA-N |
| XLogP | 2.39 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|