About (5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide
(5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide (PubChem CID 57220476) has the molecular formula C7H2Cl2N3S-
and a molecular weight of 231.09 g/mol. Its IUPAC name is (5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide.
Molecular Properties
| Compound Name | (5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide |
| PubChem CID | 57220476 |
| Molecular Formula | C7H2Cl2N3S- |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 229.94 |
| IUPAC Name | (5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide |
| SMILES | [N-]=Nc1nc2cc(Cl)c(Cl)cc2s1 |
| InChI | InChI=1S/C7H2Cl2N3S/c8-3-1-5-6(2-4(3)9)13-7(11-5)12-10/h1-2H/q-1 |
| InChIKey | TZKSBNBZYWNEEG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide?
The IUPAC name of (5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide (CID 57220476) is (5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide.
What is the SMILES notation for (5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide?
The canonical SMILES for (5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide is [N-]=Nc1nc2cc(Cl)c(Cl)cc2s1.
What is the InChIKey of (5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide?
The InChIKey is TZKSBNBZYWNEEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Cl2N3S/c8-3-1-5-6(2-4(3)9)13-7(11-5)12-10/h1-2H/q-1.
What are the key properties of (5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide?
(5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide has a molecular weight of 231.09 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6-dichloro-1,3-benzothiazol-2-yl)iminoazanide is sourced from PubChem (CID 57220476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).