C10H10F8O — CID 57220540
[2-(2-cyclopropyl-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethyl]cyclopropane (PubChem CID 57220540) has the molecular formula C10H10F8O and a molecular weight of 298.17 g/mol. Its IUPAC name is [2-(2-cyclopropyl-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethyl]cyclopropane.
| Compound Name | [2-(2-cyclopropyl-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethyl]cyclopropane |
|---|---|
| PubChem CID | 57220540 |
| Molecular Formula | C10H10F8O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | [2-(2-cyclopropyl-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethyl]cyclopropane |
| SMILES | FC(F)(OC(F)(F)C(F)(F)C1CC1)C(F)(F)C1CC1 |
| InChI | InChI=1S/C10H10F8O/c11-7(12,5-1-2-5)9(15,16)19-10(17,18)8(13,14)6-3-4-6/h5-6H,1-4H2 |
| InChIKey | BFBRQJDCFRWICJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|