C16H33NO4 — CID 57220548
(2S,3R)-3-hydroxy-2-(2-hydroxydodecylamino)butanoic acid (PubChem CID 57220548) has the molecular formula C16H33NO4 and a molecular weight of 303.44 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-(2-hydroxydodecylamino)butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-(2-hydroxydodecylamino)butanoic acid |
|---|---|
| PubChem CID | 57220548 |
| Molecular Formula | C16H33NO4 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-(2-hydroxydodecylamino)butanoic acid |
| SMILES | CCCCCCCCCCC(O)CN[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C16H33NO4/c1-3-4-5-6-7-8-9-10-11-14(19)12-17-15(13(2)18)16(20)21/h13-15,17-19H,3-12H2,1-2H3,(H,20,21)/t13-,14?,15+/m1/s1 |
| InChIKey | JKGWWOLGUUAWDS-LOWNFYCTSA-N |
| XLogP | 2.30 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|