About 1,1-diazidoethane
1,1-diazidoethane (PubChem CID 57220591) has the molecular formula C2H4N6
and a molecular weight of 112.10 g/mol. Its IUPAC name is 1,1-diazidoethane.
Molecular Properties
| Compound Name | 1,1-diazidoethane |
| PubChem CID | 57220591 |
| Molecular Formula | C2H4N6 |
| Molecular Weight | 112.10 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | 1,1-diazidoethane |
| SMILES | CC(N=[N+]=[N-])N=[N+]=[N-] |
| InChI | InChI=1S/C2H4N6/c1-2(5-7-3)6-8-4/h2H,1H3 |
| InChIKey | SIMSDIVPQRMJTO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.10 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diazidoethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diazidoethane?
The IUPAC name of 1,1-diazidoethane (CID 57220591) is 1,1-diazidoethane.
What is the SMILES notation for 1,1-diazidoethane?
The canonical SMILES for 1,1-diazidoethane is CC(N=[N+]=[N-])N=[N+]=[N-].
What is the InChIKey of 1,1-diazidoethane?
The InChIKey is SIMSDIVPQRMJTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N6/c1-2(5-7-3)6-8-4/h2H,1H3.
What are the key properties of 1,1-diazidoethane?
1,1-diazidoethane has a molecular weight of 112.10 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diazidoethane is sourced from PubChem (CID 57220591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).