C25H23N5O — CID 57220820
N-[2-[amino-(4-cyanophenyl)methyl]-1-methylbenzimidazol-5-yl]-N-methyl-2-phenylacetamide (PubChem CID 57220820) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[2-[amino-(4-cyanophenyl)methyl]-1-methylbenzimidazol-5-yl]-N-methyl-2-phenylacetamide.
| Compound Name | N-[2-[amino-(4-cyanophenyl)methyl]-1-methylbenzimidazol-5-yl]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 57220820 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-[2-[amino-(4-cyanophenyl)methyl]-1-methylbenzimidazol-5-yl]-N-methyl-2-phenylacetamide |
| SMILES | CN(C(=O)Cc1ccccc1)c1ccc2c(c1)nc(C(N)c1ccc(C#N)cc1)n2C |
| InChI | InChI=1S/C25H23N5O/c1-29(23(31)14-17-6-4-3-5-7-17)20-12-13-22-21(15-20)28-25(30(22)2)24(27)19-10-8-18(16-26)9-11-19/h3-13,15,24H,14,27H2,1-2H3 |
| InChIKey | YHHWRDJGUBCALL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |