About bis(N-ethylanilino) benzene-1,4-disulfonate
bis(N-ethylanilino) benzene-1,4-disulfonate (PubChem CID 57221267) has the molecular formula C22H24N2O6S2
and a molecular weight of 476.58 g/mol. Its IUPAC name is bis(N-ethylanilino) benzene-1,4-disulfonate.
Molecular Properties
| Compound Name | bis(N-ethylanilino) benzene-1,4-disulfonate |
| PubChem CID | 57221267 |
| Molecular Formula | C22H24N2O6S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | bis(N-ethylanilino) benzene-1,4-disulfonate |
| SMILES | CCN(OS(=O)(=O)c1ccc(S(=O)(=O)ON(CC)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O6S2/c1-3-23(19-11-7-5-8-12-19)29-31(25,26)21-15-17-22(18-16-21)32(27,28)30-24(4-2)20-13-9-6-10-14-20/h5-18H,3-4H2,1-2H3 |
| InChIKey | XNGDEQVVYYPKPC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(N-ethylanilino) benzene-1,4-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-ethylanilino) benzene-1,4-disulfonate?
The IUPAC name of bis(N-ethylanilino) benzene-1,4-disulfonate (CID 57221267) is bis(N-ethylanilino) benzene-1,4-disulfonate.
What is the SMILES notation for bis(N-ethylanilino) benzene-1,4-disulfonate?
The canonical SMILES for bis(N-ethylanilino) benzene-1,4-disulfonate is CCN(OS(=O)(=O)c1ccc(S(=O)(=O)ON(CC)c2ccccc2)cc1)c1ccccc1.
What is the InChIKey of bis(N-ethylanilino) benzene-1,4-disulfonate?
The InChIKey is XNGDEQVVYYPKPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O6S2/c1-3-23(19-11-7-5-8-12-19)29-31(25,26)21-15-17-22(18-16-21)32(27,28)30-24(4-2)20-13-9-6-10-14-20/h5-18H,3-4H2,1-2H3.
What are the key properties of bis(N-ethylanilino) benzene-1,4-disulfonate?
bis(N-ethylanilino) benzene-1,4-disulfonate has a molecular weight of 476.58 g/mol, XLogP of 3.98, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-ethylanilino) benzene-1,4-disulfonate is sourced from PubChem (CID 57221267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).