C29H39ClN2O2 — CID 57221487
(3aS,3bS,9aR,9bR,11aS)-N-(3-chloro-2-methylpropyl)-9a,11a-dimethyl-7-oxo-N-phenyl-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridine-1-carboxamide (PubChem CID 57221487) has the molecular formula C29H39ClN2O2 and a molecular weight of 483.10 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aS)-N-(3-chloro-2-methylpropyl)-9a,11a-dimethyl-7-oxo-N-phenyl-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridine-1-carboxamide.
| Compound Name | (3aS,3bS,9aR,9bR,11aS)-N-(3-chloro-2-methylpropyl)-9a,11a-dimethyl-7-oxo-N-phenyl-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridine-1-carboxamide |
|---|---|
| PubChem CID | 57221487 |
| Molecular Formula | C29H39ClN2O2 |
| Molecular Weight | 483.10 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aS)-N-(3-chloro-2-methylpropyl)-9a,11a-dimethyl-7-oxo-N-phenyl-1,2,3,3a,3b,4,6,8,9,9b,10,11-dodecahydrocyclopenta[i]phenanthridine-1-carboxamide |
| SMILES | CC(CCl)CN(C(=O)C1CC[C@H]2[C@@H]3CN=C4CC(=O)CC[C@]4(C)[C@@H]3CC[C@]12C)c1ccccc1 |
| InChI | InChI=1S/C29H39ClN2O2/c1-19(16-30)18-32(20-7-5-4-6-8-20)27(34)25-10-9-23-22-17-31-26-15-21(33)11-13-29(26,3)24(22)12-14-28(23,25)2/h4-8,19,22-25H,9-18H2,1-3H3/t19?,22-,23-,24+,25?,28-,29+/m0/s1 |
| InChIKey | VGRBCHAROGWDSY-LVVVWLLVSA-N |
| XLogP | 6.17 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.10 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|