C21H28N2O2S2 — CID 57221491
2-(3-amino-3-methyl-6-thiophen-2-ylhexyl)-5,6-dimethoxy-3H-isoindole-1-thione (PubChem CID 57221491) has the molecular formula C21H28N2O2S2 and a molecular weight of 404.60 g/mol. Its IUPAC name is 2-(3-amino-3-methyl-6-thiophen-2-ylhexyl)-5,6-dimethoxy-3H-isoindole-1-thione.
| Compound Name | 2-(3-amino-3-methyl-6-thiophen-2-ylhexyl)-5,6-dimethoxy-3H-isoindole-1-thione |
|---|---|
| PubChem CID | 57221491 |
| Molecular Formula | C21H28N2O2S2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 2-(3-amino-3-methyl-6-thiophen-2-ylhexyl)-5,6-dimethoxy-3H-isoindole-1-thione |
| SMILES | COc1cc2c(cc1OC)C(=S)N(CCC(C)(N)CCCc1cccs1)C2 |
| InChI | InChI=1S/C21H28N2O2S2/c1-21(22,8-4-6-16-7-5-11-27-16)9-10-23-14-15-12-18(24-2)19(25-3)13-17(15)20(23)26/h5,7,11-13H,4,6,8-10,14,22H2,1-3H3 |
| InChIKey | OSZMXDRMFTVFDE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|