C11H21N5 — CID 57221585
1-cyano-2-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine (PubChem CID 57221585) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-cyano-2-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine.
| Compound Name | 1-cyano-2-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 57221585 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 1-cyano-2-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine |
| SMILES | CC1(C)CC(/N=C(\N)NC#N)CC(C)(C)N1 |
| InChI | InChI=1S/C11H21N5/c1-10(2)5-8(6-11(3,4)16-10)15-9(13)14-7-12/h8,16H,5-6H2,1-4H3,(H3,13,14,15) |
| InChIKey | ZEUIDAAPLBJWEH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|