C19H17Cl2NO3S — CID 57221662
3-[(3,4-dichlorophenyl)-(4-methylsulfonylphenyl)methylidene]-1-methylpyrrolidin-2-one (PubChem CID 57221662) has the molecular formula C19H17Cl2NO3S and a molecular weight of 410.32 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)-(4-methylsulfonylphenyl)methylidene]-1-methylpyrrolidin-2-one.
| Compound Name | 3-[(3,4-dichlorophenyl)-(4-methylsulfonylphenyl)methylidene]-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 57221662 |
| Molecular Formula | C19H17Cl2NO3S |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)-(4-methylsulfonylphenyl)methylidene]-1-methylpyrrolidin-2-one |
| SMILES | CN1CCC(=C(c2ccc(S(C)(=O)=O)cc2)c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C19H17Cl2NO3S/c1-22-10-9-15(19(22)23)18(13-5-8-16(20)17(21)11-13)12-3-6-14(7-4-12)26(2,24)25/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | WARPISGVGWIBAL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|