C38H47N3O2Si2 — CID 57221731
[(1S,2R,3R)-3-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclobutyl]methoxy-tert-butyl-diphenylsilane (PubChem CID 57221731) has the molecular formula C38H47N3O2Si2 and a molecular weight of 633.99 g/mol. Its IUPAC name is [(1S,2R,3R)-3-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclobutyl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(1S,2R,3R)-3-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclobutyl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 57221731 |
| Molecular Formula | C38H47N3O2Si2 |
| Molecular Weight | 633.99 g/mol |
| Exact Mass | 633.32 |
| IUPAC Name | [(1S,2R,3R)-3-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclobutyl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@H]1C[C@@H](N=[N+]=[N-])[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H47N3O2Si2/c1-37(2,3)44(31-19-11-7-12-20-31,32-21-13-8-14-22-32)42-28-30-27-36(40-41-39)35(30)29-43-45(38(4,5)6,33-23-15-9-16-24-33)34-25-17-10-18-26-34/h7-26,30,35-36H,27-29H2,1-6H3/t30-,35-,36-/m1/s1 |
| InChIKey | BKFQSVBLIVSCAB-ZCFPMLOXSA-N |
| XLogP | 7.45 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.99 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|