C30H36N4O5 — CID 57221827
N-[(2S,3S)-3-hydroxy-6-(hydroxyamino)-2-(9-hydroxy-9-bicyclo[3.3.1]nonanyl)-6-oxo-1-phenylhexan-2-yl]quinoxaline-2-carboxamide (PubChem CID 57221827) has the molecular formula C30H36N4O5 and a molecular weight of 532.64 g/mol. Its IUPAC name is N-[(2S,3S)-3-hydroxy-6-(hydroxyamino)-2-(9-hydroxy-9-bicyclo[3.3.1]nonanyl)-6-oxo-1-phenylhexan-2-yl]quinoxaline-2-carboxamide.
| Compound Name | N-[(2S,3S)-3-hydroxy-6-(hydroxyamino)-2-(9-hydroxy-9-bicyclo[3.3.1]nonanyl)-6-oxo-1-phenylhexan-2-yl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 57221827 |
| Molecular Formula | C30H36N4O5 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | N-[(2S,3S)-3-hydroxy-6-(hydroxyamino)-2-(9-hydroxy-9-bicyclo[3.3.1]nonanyl)-6-oxo-1-phenylhexan-2-yl]quinoxaline-2-carboxamide |
| SMILES | O=C(CC[C@H](O)[C@](Cc1ccccc1)(NC(=O)c1cnc2ccccc2n1)C1(O)C2CCCC1CCC2)NO |
| InChI | InChI=1S/C30H36N4O5/c35-26(16-17-27(36)34-39)29(18-20-8-2-1-3-9-20,30(38)21-10-6-11-22(30)13-7-12-21)33-28(37)25-19-31-23-14-4-5-15-24(23)32-25/h1-5,8-9,14-15,19,21-22,26,35,38-39H,6-7,10-13,16-18H2,(H,33,37)(H,34,36)/t21?,22?,26-,29-,30?/m0/s1 |
| InChIKey | SZVYYESJXVXHPQ-IPTXWDFPSA-N |
| XLogP | 3.32 |
| TPSA | 144.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|