About (1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate
(1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate (PubChem CID 57221837) has the molecular formula C12H15N3O5
and a molecular weight of 281.27 g/mol. Its IUPAC name is (1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | (1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate |
| PubChem CID | 57221837 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate |
| SMILES | CC(C)c1noc(NC=O)c1C(=O)OC1(C(N)=O)CC1 |
| InChI | InChI=1S/C12H15N3O5/c1-6(2)8-7(9(14-5-16)20-15-8)10(17)19-12(3-4-12)11(13)18/h5-6H,3-4H2,1-2H3,(H2,13,18)(H,14,16) |
| InChIKey | YIEHFZRWAVKSQC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate?
The IUPAC name of (1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate (CID 57221837) is (1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for (1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate?
The canonical SMILES for (1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate is CC(C)c1noc(NC=O)c1C(=O)OC1(C(N)=O)CC1.
What is the InChIKey of (1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate?
The InChIKey is YIEHFZRWAVKSQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O5/c1-6(2)8-7(9(14-5-16)20-15-8)10(17)19-12(3-4-12)11(13)18/h5-6H,3-4H2,1-2H3,(H2,13,18)(H,14,16).
What are the key properties of (1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate?
(1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate has a molecular weight of 281.27 g/mol, XLogP of 0.54, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carbamoylcyclopropyl) 5-formamido-3-propan-2-yl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 57221837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).