About tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane
tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane (PubChem CID 57222483) has the molecular formula C16H31NOSi
and a molecular weight of 281.52 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane |
| PubChem CID | 57222483 |
| Molecular Formula | C16H31NOSi |
| Molecular Weight | 281.52 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane |
| SMILES | C=C[C@@H]1C2CCC(C[C@@H]1O[Si](C)(C)C(C)(C)C)N2C |
| InChI | InChI=1S/C16H31NOSi/c1-8-13-14-10-9-12(17(14)5)11-15(13)18-19(6,7)16(2,3)4/h8,12-15H,1,9-11H2,2-7H3/t12?,13-,14?,15+/m1/s1 |
| InChIKey | HYEKOJYAJOCPRM-JYVUQVBGSA-N |
| XLogP | 4.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane?
The IUPAC name of tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane (CID 57222483) is tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane is C=C[C@@H]1C2CCC(C[C@@H]1O[Si](C)(C)C(C)(C)C)N2C.
What is the InChIKey of tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane?
The InChIKey is HYEKOJYAJOCPRM-JYVUQVBGSA-N. The full InChI is InChI=1S/C16H31NOSi/c1-8-13-14-10-9-12(17(14)5)11-15(13)18-19(6,7)16(2,3)4/h8,12-15H,1,9-11H2,2-7H3/t12?,13-,14?,15+/m1/s1.
What are the key properties of tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane?
tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane has a molecular weight of 281.52 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[[(2R,3S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-dimethylsilane is sourced from PubChem (CID 57222483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).