C20H29N3O3 — CID 57222911
tert-butyl N-[(1S)-2-methyl-1-[1-(phenylmethoxymethyl)imidazol-2-yl]propyl]carbamate (PubChem CID 57222911) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-methyl-1-[1-(phenylmethoxymethyl)imidazol-2-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-methyl-1-[1-(phenylmethoxymethyl)imidazol-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 57222911 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | tert-butyl N-[(1S)-2-methyl-1-[1-(phenylmethoxymethyl)imidazol-2-yl]propyl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)c1nccn1COCc1ccccc1 |
| InChI | InChI=1S/C20H29N3O3/c1-15(2)17(22-19(24)26-20(3,4)5)18-21-11-12-23(18)14-25-13-16-9-7-6-8-10-16/h6-12,15,17H,13-14H2,1-5H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | XQEREBVJCBHONN-KRWDZBQOSA-N |
| XLogP | 4.28 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |