About 1-cyclopenta-2,4-dien-1-ylideneethanamine
1-cyclopenta-2,4-dien-1-ylideneethanamine (PubChem CID 572231) has the molecular formula C7H9N
and a molecular weight of 107.16 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylideneethanamine.
Analyze 1-cyclopenta-2,4-dien-1-ylideneethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-ylideneethanamine?
The IUPAC name of 1-cyclopenta-2,4-dien-1-ylideneethanamine (CID 572231) is 1-cyclopenta-2,4-dien-1-ylideneethanamine.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-ylideneethanamine?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-ylideneethanamine is CC(N)=C1C=CC=C1.
What is the InChIKey of 1-cyclopenta-2,4-dien-1-ylideneethanamine?
The InChIKey is NQMAZILNWHLNBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N/c1-6(8)7-4-2-3-5-7/h2-5H,8H2,1H3.
What are the key properties of 1-cyclopenta-2,4-dien-1-ylideneethanamine?
1-cyclopenta-2,4-dien-1-ylideneethanamine has a molecular weight of 107.16 g/mol, XLogP of 1.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-ylideneethanamine is sourced from PubChem (CID 572231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).