C21H32F2O4 — CID 57223247
methyl 7-[(1R,2R)-2-[(4R)-5,5-difluoro-4-hydroxyoctyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate (PubChem CID 57223247) has the molecular formula C21H32F2O4 and a molecular weight of 386.48 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-[(4R)-5,5-difluoro-4-hydroxyoctyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R)-2-[(4R)-5,5-difluoro-4-hydroxyoctyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 57223247 |
| Molecular Formula | C21H32F2O4 |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | methyl 7-[(1R,2R)-2-[(4R)-5,5-difluoro-4-hydroxyoctyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
| SMILES | CCCC(F)(F)[C@H](O)CCC[C@@H]1C=CC(=O)[C@@H]1CC=CCCCC(=O)OC |
| InChI | InChI=1S/C21H32F2O4/c1-3-15-21(22,23)19(25)11-8-9-16-13-14-18(24)17(16)10-6-4-5-7-12-20(26)27-2/h4,6,13-14,16-17,19,25H,3,5,7-12,15H2,1-2H3/t16-,17-,19-/m1/s1 |
| InChIKey | MWCQLCZXRHRGTE-ZHALLVOQSA-N |
| XLogP | 4.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|