About tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate
tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate (PubChem CID 57223411) has the molecular formula C20H37NO6
and a molecular weight of 387.52 g/mol. Its IUPAC name is tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate |
| PubChem CID | 57223411 |
| Molecular Formula | C20H37NO6 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate |
| SMILES | CCC[C@H](NC(=O)OC(C)(C)C)[C@@H](O)C=C(CO)CCOC1CCCCO1 |
| InChI | InChI=1S/C20H37NO6/c1-5-8-16(21-19(24)27-20(2,3)4)17(23)13-15(14-22)10-12-26-18-9-6-7-11-25-18/h13,16-18,22-23H,5-12,14H2,1-4H3,(H,21,24)/t16-,17-,18?/m0/s1 |
| InChIKey | IBWGPFDJNNXZOA-UBFHEZILSA-N |
| XLogP | 2.89 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate?
The IUPAC name of tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate (CID 57223411) is tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate?
The canonical SMILES for tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate is CCC[C@H](NC(=O)OC(C)(C)C)[C@@H](O)C=C(CO)CCOC1CCCCO1.
What is the InChIKey of tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate?
The InChIKey is IBWGPFDJNNXZOA-UBFHEZILSA-N. The full InChI is InChI=1S/C20H37NO6/c1-5-8-16(21-19(24)27-20(2,3)4)17(23)13-15(14-22)10-12-26-18-9-6-7-11-25-18/h13,16-18,22-23H,5-12,14H2,1-4H3,(H,21,24)/t16-,17-,18?/m0/s1.
What are the key properties of tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate?
tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate has a molecular weight of 387.52 g/mol, XLogP of 2.89, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(4S,5S)-5-hydroxy-7-(hydroxymethyl)-9-(oxan-2-yloxy)non-6-en-4-yl]carbamate is sourced from PubChem (CID 57223411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).