6-nitrocyclohexa-1,3-diene-1-carboxylic acid

C7H7NO4 — CID 57223480

IUPAC6-nitrocyclohexa-1,3-diene-1-carboxylic acid
SMILESO=C(O)C1=CC=CCC1[N+](=O)[O-]
InChIInChI=1S/C7H7NO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-3,6H,4H2,(H,9,10)
InChIKeyMYPJHZVSGPZYJI-UHFFFAOYSA-N
MW169.14 g/mol
LogP0.60
Rot. Bonds2

About 6-nitrocyclohexa-1,3-diene-1-carboxylic acid

6-nitrocyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 57223480) has the molecular formula C7H7NO4 and a molecular weight of 169.14 g/mol. Its IUPAC name is 6-nitrocyclohexa-1,3-diene-1-carboxylic acid.

Molecular Properties

Compound Name6-nitrocyclohexa-1,3-diene-1-carboxylic acid
PubChem CID57223480
Molecular FormulaC7H7NO4
Molecular Weight169.14 g/mol
Exact Mass169.04
IUPAC Name6-nitrocyclohexa-1,3-diene-1-carboxylic acid
SMILESO=C(O)C1=CC=CCC1[N+](=O)[O-]
InChIInChI=1S/C7H7NO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-3,6H,4H2,(H,9,10)
InChIKeyMYPJHZVSGPZYJI-UHFFFAOYSA-N
XLogP0.60
TPSA80.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.14
LogP ≤ 50.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 6-nitrocyclohexa-1,3-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-nitrocyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 6-nitrocyclohexa-1,3-diene-1-carboxylic acid (CID 57223480) is 6-nitrocyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 6-nitrocyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 6-nitrocyclohexa-1,3-diene-1-carboxylic acid is O=C(O)C1=CC=CCC1[N+](=O)[O-].
What is the InChIKey of 6-nitrocyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is MYPJHZVSGPZYJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-3,6H,4H2,(H,9,10).
What are the key properties of 6-nitrocyclohexa-1,3-diene-1-carboxylic acid?
6-nitrocyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 169.14 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitrocyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 57223480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).