C7H11NO — CID 57223554
6-methyl-1,2,3,6-tetrahydropyridine-5-carbaldehyde (PubChem CID 57223554) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 6-methyl-1,2,3,6-tetrahydropyridine-5-carbaldehyde.
| Compound Name | 6-methyl-1,2,3,6-tetrahydropyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 57223554 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 6-methyl-1,2,3,6-tetrahydropyridine-5-carbaldehyde |
| SMILES | CC1NCCC=C1C=O |
| InChI | InChI=1S/C7H11NO/c1-6-7(5-9)3-2-4-8-6/h3,5-6,8H,2,4H2,1H3 |
| InChIKey | KNPCRATWKIBOFQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|