About 2-pentyltrideca-4,8-diene-1,11-diamine
2-pentyltrideca-4,8-diene-1,11-diamine (PubChem CID 57223971) has the molecular formula C18H36N2
and a molecular weight of 280.50 g/mol. Its IUPAC name is 2-pentyltrideca-4,8-diene-1,11-diamine.
Molecular Properties
| Compound Name | 2-pentyltrideca-4,8-diene-1,11-diamine |
| PubChem CID | 57223971 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 2-pentyltrideca-4,8-diene-1,11-diamine |
| SMILES | CCCCCC(CN)CC=CCCC=CCC(N)CC |
| InChI | InChI=1S/C18H36N2/c1-3-5-10-13-17(16-19)14-11-8-6-7-9-12-15-18(20)4-2/h8-9,11-12,17-18H,3-7,10,13-16,19-20H2,1-2H3 |
| InChIKey | CUYPFAFEFLYPNQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyltrideca-4,8-diene-1,11-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyltrideca-4,8-diene-1,11-diamine?
The IUPAC name of 2-pentyltrideca-4,8-diene-1,11-diamine (CID 57223971) is 2-pentyltrideca-4,8-diene-1,11-diamine.
What is the SMILES notation for 2-pentyltrideca-4,8-diene-1,11-diamine?
The canonical SMILES for 2-pentyltrideca-4,8-diene-1,11-diamine is CCCCCC(CN)CC=CCCC=CCC(N)CC.
What is the InChIKey of 2-pentyltrideca-4,8-diene-1,11-diamine?
The InChIKey is CUYPFAFEFLYPNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2/c1-3-5-10-13-17(16-19)14-11-8-6-7-9-12-15-18(20)4-2/h8-9,11-12,17-18H,3-7,10,13-16,19-20H2,1-2H3.
What are the key properties of 2-pentyltrideca-4,8-diene-1,11-diamine?
2-pentyltrideca-4,8-diene-1,11-diamine has a molecular weight of 280.50 g/mol, XLogP of 4.55, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyltrideca-4,8-diene-1,11-diamine is sourced from PubChem (CID 57223971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).