About 2-iminocyclohexane-1,3-diamine
2-iminocyclohexane-1,3-diamine (PubChem CID 57224131) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is 2-iminocyclohexane-1,3-diamine.
Molecular Properties
| Compound Name | 2-iminocyclohexane-1,3-diamine |
| PubChem CID | 57224131 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 2-iminocyclohexane-1,3-diamine |
| SMILES | [H]N=C1C(N)CCCC1N |
| InChI | InChI=1S/C6H13N3/c7-4-2-1-3-5(8)6(4)9/h4-5,9H,1-3,7-8H2 |
| InChIKey | SFNSSERRAROWFO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminocyclohexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminocyclohexane-1,3-diamine?
The IUPAC name of 2-iminocyclohexane-1,3-diamine (CID 57224131) is 2-iminocyclohexane-1,3-diamine.
What is the SMILES notation for 2-iminocyclohexane-1,3-diamine?
The canonical SMILES for 2-iminocyclohexane-1,3-diamine is [H]N=C1C(N)CCCC1N.
What is the InChIKey of 2-iminocyclohexane-1,3-diamine?
The InChIKey is SFNSSERRAROWFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3/c7-4-2-1-3-5(8)6(4)9/h4-5,9H,1-3,7-8H2.
What are the key properties of 2-iminocyclohexane-1,3-diamine?
2-iminocyclohexane-1,3-diamine has a molecular weight of 127.19 g/mol, XLogP of -0.16, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminocyclohexane-1,3-diamine is sourced from PubChem (CID 57224131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).