About N-tert-butyl-N'-ethyl-N'-formyloxamide
N-tert-butyl-N'-ethyl-N'-formyloxamide (PubChem CID 57224343) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is N-tert-butyl-N'-ethyl-N'-formyloxamide.
Molecular Properties
| Compound Name | N-tert-butyl-N'-ethyl-N'-formyloxamide |
| PubChem CID | 57224343 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | N-tert-butyl-N'-ethyl-N'-formyloxamide |
| SMILES | CCN(C=O)C(=O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C9H16N2O3/c1-5-11(6-12)8(14)7(13)10-9(2,3)4/h6H,5H2,1-4H3,(H,10,13) |
| InChIKey | FFCMLYMKKUOWRF-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N'-ethyl-N'-formyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-ethyl-N'-formyloxamide?
The IUPAC name of N-tert-butyl-N'-ethyl-N'-formyloxamide (CID 57224343) is N-tert-butyl-N'-ethyl-N'-formyloxamide.
What is the SMILES notation for N-tert-butyl-N'-ethyl-N'-formyloxamide?
The canonical SMILES for N-tert-butyl-N'-ethyl-N'-formyloxamide is CCN(C=O)C(=O)C(=O)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-N'-ethyl-N'-formyloxamide?
The InChIKey is FFCMLYMKKUOWRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-5-11(6-12)8(14)7(13)10-9(2,3)4/h6H,5H2,1-4H3,(H,10,13).
What are the key properties of N-tert-butyl-N'-ethyl-N'-formyloxamide?
N-tert-butyl-N'-ethyl-N'-formyloxamide has a molecular weight of 200.24 g/mol, XLogP of -0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-ethyl-N'-formyloxamide is sourced from PubChem (CID 57224343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).